191-24-2 Benzo[ghi]perylene
اسم المنتج |
Benzo[ghi]perylene |
الاسم بالانجليزية |
Benzo[ghi]perylene; 1,12-Benzoperylene; Benzo[ghi]perylene (purity); benzo(g h i)perylene |
الصيغة الجزيئية |
C22H12 |
الوزن الجزيئي الغرامي |
276.3307 |
InChI |
InChI=1/C22H12/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-12H |
إستراتيجية المساعدة القطرية |
191-24-2 |
المفوضية الأوروبية رقم |
205-883-8 |
بنية جزيئية |
|
كثافة |
1.378g/cm3 |
درجة الإنصهار |
276-280℃ |
نقطة الغليان |
501°C at 760 mmHg |
معامل الإنكسار |
2.009 |
نقطة الوميض |
247.2°C |
ضغط البخار |
1.12E-09mmHg at 25°C |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R40:Possible risks of irreversible effects.;
|
شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|